C7H8ClF2N3O — CID 164656552
5-amino-2-(3-chloro-3,3-difluoropropyl)pyridazin-3-one (PubChem CID 164656552) has the molecular formula C7H8ClF2N3O and a molecular weight of 223.61 g/mol. Its IUPAC name is 5-amino-2-(3-chloro-3,3-difluoropropyl)pyridazin-3-one.
| Compound Name | 5-amino-2-(3-chloro-3,3-difluoropropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 164656552 |
| Molecular Formula | C7H8ClF2N3O |
| Molecular Weight | 223.61 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 5-amino-2-(3-chloro-3,3-difluoropropyl)pyridazin-3-one |
| SMILES | Nc1cnn(CCC(F)(F)Cl)c(=O)c1 |
| InChI | InChI=1S/C7H8ClF2N3O/c8-7(9,10)1-2-13-6(14)3-5(11)4-12-13/h3-4H,1-2,11H2 |
| InChIKey | RIYVFDPPPOYCSA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.61 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|