C9H15N3OS — CID 164659077
(4-methylmorpholin-2-yl)-(1,3-thiazol-5-yl)methanamine (PubChem CID 164659077) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is (4-methylmorpholin-2-yl)-(1,3-thiazol-5-yl)methanamine.
| Compound Name | (4-methylmorpholin-2-yl)-(1,3-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 164659077 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (4-methylmorpholin-2-yl)-(1,3-thiazol-5-yl)methanamine |
| SMILES | CN1CCOC(C(N)c2cncs2)C1 |
| InChI | InChI=1S/C9H15N3OS/c1-12-2-3-13-7(5-12)9(10)8-4-11-6-14-8/h4,6-7,9H,2-3,5,10H2,1H3 |
| InChIKey | KHOLETBQDIVEID-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |