C8H5BrN2OS — CID 164661819
(5-bromo-1,3-thiazol-4-yl)-(1H-pyrrol-2-yl)methanone (PubChem CID 164661819) has the molecular formula C8H5BrN2OS and a molecular weight of 257.11 g/mol. Its IUPAC name is (5-bromo-1,3-thiazol-4-yl)-(1H-pyrrol-2-yl)methanone.
| Compound Name | (5-bromo-1,3-thiazol-4-yl)-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 164661819 |
| Molecular Formula | C8H5BrN2OS |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 255.93 |
| IUPAC Name | (5-bromo-1,3-thiazol-4-yl)-(1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1ccc[nH]1)c1ncsc1Br |
| InChI | InChI=1S/C8H5BrN2OS/c9-8-6(11-4-13-8)7(12)5-2-1-3-10-5/h1-4,10H |
| InChIKey | RNAVWYLOHJQELI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |