C21H23F3N2O — CID 164665723
1-(2,2-dimethyl-4-phenylpent-4-enyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 164665723) has the molecular formula C21H23F3N2O and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-phenylpent-4-enyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2,2-dimethyl-4-phenylpent-4-enyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 164665723 |
| Molecular Formula | C21H23F3N2O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-(2,2-dimethyl-4-phenylpent-4-enyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | C=C(CC(C)(C)CNC(=O)Nc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C21H23F3N2O/c1-15(16-8-5-4-6-9-16)13-20(2,3)14-25-19(27)26-18-11-7-10-17(12-18)21(22,23)24/h4-12H,1,13-14H2,2-3H3,(H2,25,26,27) |
| InChIKey | VFYKITAQIICJNW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |