C14H8F5NO5 — CID 164665873
methyl 9b-hydroxy-5-oxo-2-(1,1,2,2,2-pentafluoroethyl)-[1,2]oxazolo[3,2-a]isoindole-1-carboxylate (PubChem CID 164665873) has the molecular formula C14H8F5NO5 and a molecular weight of 365.21 g/mol. Its IUPAC name is methyl 9b-hydroxy-5-oxo-2-(1,1,2,2,2-pentafluoroethyl)-[1,2]oxazolo[3,2-a]isoindole-1-carboxylate.
| Compound Name | methyl 9b-hydroxy-5-oxo-2-(1,1,2,2,2-pentafluoroethyl)-[1,2]oxazolo[3,2-a]isoindole-1-carboxylate |
|---|---|
| PubChem CID | 164665873 |
| Molecular Formula | C14H8F5NO5 |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | methyl 9b-hydroxy-5-oxo-2-(1,1,2,2,2-pentafluoroethyl)-[1,2]oxazolo[3,2-a]isoindole-1-carboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)C(F)(F)F)ON2C(=O)c3ccccc3C12O |
| InChI | InChI=1S/C14H8F5NO5/c1-24-11(22)8-9(13(15,16)14(17,18)19)25-20-10(21)6-4-2-3-5-7(6)12(8,20)23/h2-5,23H,1H3 |
| InChIKey | FNDDRCNFXGOHRI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|