C21H19NO9 — CID 155936952
12-O-ethyl 13-O,14-O-dimethyl (1S,10S,12R)-10-methyl-8,11-dioxo-15-oxa-9-azatetracyclo[10.2.1.01,9.02,7]pentadeca-2,4,6,13-tetraene-12,13,14-tricarboxylate (PubChem CID 155936952) has the molecular formula C21H19NO9 and a molecular weight of 429.38 g/mol. Its IUPAC name is 12-O-ethyl 13-O,14-O-dimethyl (1S,10S,12R)-10-methyl-8,11-dioxo-15-oxa-9-azatetracyclo[10.2.1.01,9.02,7]pentadeca-2,4,6,13-tetraene-12,13,14-tricarboxylate.
| Compound Name | 12-O-ethyl 13-O,14-O-dimethyl (1S,10S,12R)-10-methyl-8,11-dioxo-15-oxa-9-azatetracyclo[10.2.1.01,9.02,7]pentadeca-2,4,6,13-tetraene-12,13,14-tricarboxylate |
|---|---|
| PubChem CID | 155936952 |
| Molecular Formula | C21H19NO9 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 12-O-ethyl 13-O,14-O-dimethyl (1S,10S,12R)-10-methyl-8,11-dioxo-15-oxa-9-azatetracyclo[10.2.1.01,9.02,7]pentadeca-2,4,6,13-tetraene-12,13,14-tricarboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@]3(C(C(=O)OC)=C1C(=O)OC)c1ccccc1C(=O)N3[C@@H](C)C2=O |
| InChI | InChI=1S/C21H19NO9/c1-5-30-19(27)20-13(17(25)28-3)14(18(26)29-4)21(31-20)12-9-7-6-8-11(12)16(24)22(21)10(2)15(20)23/h6-10H,5H2,1-4H3/t10-,20+,21-/m0/s1 |
| InChIKey | JGESGUGBYDNNQJ-PWUCGIEGSA-N |
| XLogP | 0.24 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|