C24H21NO7 — CID 10048593
9-O-ethyl 10-O,11-O-dimethyl (1R,9R)-8-oxo-12-phenyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-9,10,11-tricarboxylate (PubChem CID 10048593) has the molecular formula C24H21NO7 and a molecular weight of 435.43 g/mol. Its IUPAC name is 9-O-ethyl 10-O,11-O-dimethyl (1R,9R)-8-oxo-12-phenyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-9,10,11-tricarboxylate.
| Compound Name | 9-O-ethyl 10-O,11-O-dimethyl (1R,9R)-8-oxo-12-phenyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-9,10,11-tricarboxylate |
|---|---|
| PubChem CID | 10048593 |
| Molecular Formula | C24H21NO7 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 9-O-ethyl 10-O,11-O-dimethyl (1R,9R)-8-oxo-12-phenyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-9,10,11-tricarboxylate |
| SMILES | CCOC(=O)[C@]12C(=O)c3ccccc3[C@H](C(C(=O)OC)=C1C(=O)OC)N2c1ccccc1 |
| InChI | InChI=1S/C24H21NO7/c1-4-32-23(29)24-18(22(28)31-3)17(21(27)30-2)19(25(24)14-10-6-5-7-11-14)15-12-8-9-13-16(15)20(24)26/h5-13,19H,4H2,1-3H3/t19-,24-/m1/s1 |
| InChIKey | QTFGWRURYFTARO-NTKDMRAZSA-N |
| XLogP | 2.39 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|