C16H20FNO2 — CID 164666231
2-methylpropyl (6R)-6-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 164666231) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-methylpropyl (6R)-6-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | 2-methylpropyl (6R)-6-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 164666231 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-methylpropyl (6R)-6-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC=C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FNO2/c1-12(2)11-20-16(19)18-10-4-3-5-15(18)13-6-8-14(17)9-7-13/h3,5-9,12,15H,4,10-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | FUDKDMCLLUHQLV-OAHLLOKOSA-N |
| XLogP | 3.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|