C25H26N4O2 — CID 164666498
(E)-[2-(1-benzyltriazol-4-yl)propan-2-ylamino]-[2-(4-methoxyphenyl)cyclopenta-2,4-dien-1-ylidene]methanol (PubChem CID 164666498) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is (E)-[2-(1-benzyltriazol-4-yl)propan-2-ylamino]-[2-(4-methoxyphenyl)cyclopenta-2,4-dien-1-ylidene]methanol.
| Compound Name | (E)-[2-(1-benzyltriazol-4-yl)propan-2-ylamino]-[2-(4-methoxyphenyl)cyclopenta-2,4-dien-1-ylidene]methanol |
|---|---|
| PubChem CID | 164666498 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (E)-[2-(1-benzyltriazol-4-yl)propan-2-ylamino]-[2-(4-methoxyphenyl)cyclopenta-2,4-dien-1-ylidene]methanol |
| SMILES | COc1ccc(C2=CC=C/C2=C(\O)NC(C)(C)c2cn(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C25H26N4O2/c1-25(2,23-17-29(28-27-23)16-18-8-5-4-6-9-18)26-24(30)22-11-7-10-21(22)19-12-14-20(31-3)15-13-19/h4-15,17,26,30H,16H2,1-3H3/b24-22+ |
| InChIKey | VGZOKEINYZLKOX-ZNTNEXAZSA-N |
| XLogP | 4.58 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|