C27H28N4O2 — CID 102128116
N-[2-(1-benzyltriazol-4-yl)propan-2-yl]-2-(4-methoxyphenyl)-6-methylbenzamide (PubChem CID 102128116) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-[2-(1-benzyltriazol-4-yl)propan-2-yl]-2-(4-methoxyphenyl)-6-methylbenzamide.
| Compound Name | N-[2-(1-benzyltriazol-4-yl)propan-2-yl]-2-(4-methoxyphenyl)-6-methylbenzamide |
|---|---|
| PubChem CID | 102128116 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | N-[2-(1-benzyltriazol-4-yl)propan-2-yl]-2-(4-methoxyphenyl)-6-methylbenzamide |
| SMILES | COc1ccc(-c2cccc(C)c2C(=O)NC(C)(C)c2cn(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C27H28N4O2/c1-19-9-8-12-23(21-13-15-22(33-4)16-14-21)25(19)26(32)28-27(2,3)24-18-31(30-29-24)17-20-10-6-5-7-11-20/h5-16,18H,17H2,1-4H3,(H,28,32) |
| InChIKey | AMHLWFUAHNOSGD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |