C22H23NO2S — CID 164666533
methyl (E)-8-cyano-6-(4-phenylsulfanylphenyl)oct-7-enoate (PubChem CID 164666533) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is methyl (E)-8-cyano-6-(4-phenylsulfanylphenyl)oct-7-enoate.
| Compound Name | methyl (E)-8-cyano-6-(4-phenylsulfanylphenyl)oct-7-enoate |
|---|---|
| PubChem CID | 164666533 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | methyl (E)-8-cyano-6-(4-phenylsulfanylphenyl)oct-7-enoate |
| SMILES | COC(=O)CCCCC(/C=C/C#N)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO2S/c1-25-22(24)12-6-5-8-18(9-7-17-23)19-13-15-21(16-14-19)26-20-10-3-2-4-11-20/h2-4,7,9-11,13-16,18H,5-6,8,12H2,1H3/b9-7+ |
| InChIKey | DFRBRSGPPLQCNL-VQHVLOKHSA-N |
| XLogP | 5.73 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|