C19H16O — CID 164666946
4-(4-methylphenyl)-1,3-dihydrobenzo[f][2]benzofuran (PubChem CID 164666946) has the molecular formula C19H16O and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1,3-dihydrobenzo[f][2]benzofuran.
| Compound Name | 4-(4-methylphenyl)-1,3-dihydrobenzo[f][2]benzofuran |
|---|---|
| PubChem CID | 164666946 |
| Molecular Formula | C19H16O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-(4-methylphenyl)-1,3-dihydrobenzo[f][2]benzofuran |
| SMILES | Cc1ccc(-c2c3c(cc4ccccc24)COC3)cc1 |
| InChI | InChI=1S/C19H16O/c1-13-6-8-14(9-7-13)19-17-5-3-2-4-15(17)10-16-11-20-12-18(16)19/h2-10H,11-12H2,1H3 |
| InChIKey | DBGKEEUYJTYZAI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |