C14H11F3O — CID 164667032
(2R,3R)-2-naphthalen-1-yl-3-(2,2,2-trifluoroethyl)oxirane (PubChem CID 164667032) has the molecular formula C14H11F3O and a molecular weight of 252.24 g/mol. Its IUPAC name is (2R,3R)-2-naphthalen-1-yl-3-(2,2,2-trifluoroethyl)oxirane.
| Compound Name | (2R,3R)-2-naphthalen-1-yl-3-(2,2,2-trifluoroethyl)oxirane |
|---|---|
| PubChem CID | 164667032 |
| Molecular Formula | C14H11F3O |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (2R,3R)-2-naphthalen-1-yl-3-(2,2,2-trifluoroethyl)oxirane |
| SMILES | FC(F)(F)C[C@H]1O[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C14H11F3O/c15-14(16,17)8-12-13(18-12)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-13H,8H2/t12-,13-/m1/s1 |
| InChIKey | UNLLKRPIZYRMMC-CHWSQXEVSA-N |
| XLogP | 4.23 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|