C26H31NO5 — CID 164667586
methyl 4-[(E,1S,2S)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylpent-3-enyl]benzoate (PubChem CID 164667586) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is methyl 4-[(E,1S,2S)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylpent-3-enyl]benzoate.
| Compound Name | methyl 4-[(E,1S,2S)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylpent-3-enyl]benzoate |
|---|---|
| PubChem CID | 164667586 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | methyl 4-[(E,1S,2S)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylpent-3-enyl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H](NC(=O)OC(C)(C)C)[C@@H](C)/C=C(\C)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31NO5/c1-17(16-18(2)23(28)20-10-8-7-9-11-20)22(27-25(30)32-26(3,4)5)19-12-14-21(15-13-19)24(29)31-6/h7-17,22H,1-6H3,(H,27,30)/b18-16+/t17-,22-/m0/s1 |
| InChIKey | GHXBRPYLNJADSO-KOUCGWBUSA-N |
| XLogP | 5.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|