C16H32OSi — CID 164669381
3,4-dimethyl-1-tri(propan-2-yl)silylpent-1-yn-3-ol (PubChem CID 164669381) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is 3,4-dimethyl-1-tri(propan-2-yl)silylpent-1-yn-3-ol.
| Compound Name | 3,4-dimethyl-1-tri(propan-2-yl)silylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 164669381 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 3,4-dimethyl-1-tri(propan-2-yl)silylpent-1-yn-3-ol |
| SMILES | CC(C)C(C)(O)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H32OSi/c1-12(2)16(9,17)10-11-18(13(3)4,14(5)6)15(7)8/h12-15,17H,1-9H3 |
| InChIKey | NORGYSLSNUGTTN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|