C22H40OSi — CID 16754359
(3S)-3-tert-butyl-6,6-dimethyl-1-tri(propan-2-yl)silylhepta-1,4-diyn-3-ol (PubChem CID 16754359) has the molecular formula C22H40OSi and a molecular weight of 348.65 g/mol. Its IUPAC name is (3S)-3-tert-butyl-6,6-dimethyl-1-tri(propan-2-yl)silylhepta-1,4-diyn-3-ol.
| Compound Name | (3S)-3-tert-butyl-6,6-dimethyl-1-tri(propan-2-yl)silylhepta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 16754359 |
| Molecular Formula | C22H40OSi |
| Molecular Weight | 348.65 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | (3S)-3-tert-butyl-6,6-dimethyl-1-tri(propan-2-yl)silylhepta-1,4-diyn-3-ol |
| SMILES | CC(C)[Si](C#C[C@@](O)(C#CC(C)(C)C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H40OSi/c1-17(2)24(18(3)4,19(5)6)16-15-22(23,21(10,11)12)14-13-20(7,8)9/h17-19,23H,1-12H3/t22-/m0/s1 |
| InChIKey | LZPJMQTVOXABEZ-QFIPXVFZSA-N |
| XLogP | 6.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|