C36H42F2O3Si — CID 164669722
[(2,6-difluoro-4-phenylmethoxyphenyl)-(2-phenylmethoxyphenyl)methoxy]-tri(propan-2-yl)silane (PubChem CID 164669722) has the molecular formula C36H42F2O3Si and a molecular weight of 588.81 g/mol. Its IUPAC name is [(2,6-difluoro-4-phenylmethoxyphenyl)-(2-phenylmethoxyphenyl)methoxy]-tri(propan-2-yl)silane.
| Compound Name | [(2,6-difluoro-4-phenylmethoxyphenyl)-(2-phenylmethoxyphenyl)methoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 164669722 |
| Molecular Formula | C36H42F2O3Si |
| Molecular Weight | 588.81 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | [(2,6-difluoro-4-phenylmethoxyphenyl)-(2-phenylmethoxyphenyl)methoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC(c1ccccc1OCc1ccccc1)c1c(F)cc(OCc2ccccc2)cc1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H42F2O3Si/c1-25(2)42(26(3)4,27(5)6)41-36(31-19-13-14-20-34(31)40-24-29-17-11-8-12-18-29)35-32(37)21-30(22-33(35)38)39-23-28-15-9-7-10-16-28/h7-22,25-27,36H,23-24H2,1-6H3 |
| InChIKey | OPOXTJXBMODQOF-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.81 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|