C12H22P+ — CID 164669825
(3E)-3-ethylidene-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-isophosphindol-2-ium (PubChem CID 164669825) has the molecular formula C12H22P+ and a molecular weight of 197.28 g/mol. Its IUPAC name is (3E)-3-ethylidene-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-isophosphindol-2-ium.
| Compound Name | (3E)-3-ethylidene-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-isophosphindol-2-ium |
|---|---|
| PubChem CID | 164669825 |
| Molecular Formula | C12H22P+ |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | (3E)-3-ethylidene-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-isophosphindol-2-ium |
| SMILES | C/C=C1\C2CCCCC2C[P+]1(C)C |
| InChI | InChI=1S/C12H22P/c1-4-12-11-8-6-5-7-10(11)9-13(12,2)3/h4,10-11H,5-9H2,1-3H3/q+1/b12-4+ |
| InChIKey | LNFKYAYQDNIMBB-UUILKARUSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|