C20H20O6 — CID 164669827
[(2S)-2-(6,6-dimethoxy-5-oxocyclohexa-1,3-dien-1-yl)-2-phenylmethoxyethyl] prop-2-ynoate (PubChem CID 164669827) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is [(2S)-2-(6,6-dimethoxy-5-oxocyclohexa-1,3-dien-1-yl)-2-phenylmethoxyethyl] prop-2-ynoate.
| Compound Name | [(2S)-2-(6,6-dimethoxy-5-oxocyclohexa-1,3-dien-1-yl)-2-phenylmethoxyethyl] prop-2-ynoate |
|---|---|
| PubChem CID | 164669827 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(2S)-2-(6,6-dimethoxy-5-oxocyclohexa-1,3-dien-1-yl)-2-phenylmethoxyethyl] prop-2-ynoate |
| SMILES | C#CC(=O)OC[C@@H](OCc1ccccc1)C1=CC=CC(=O)C1(OC)OC |
| InChI | InChI=1S/C20H20O6/c1-4-19(22)26-14-17(25-13-15-9-6-5-7-10-15)16-11-8-12-18(21)20(16,23-2)24-3/h1,5-12,17H,13-14H2,2-3H3/t17-/m1/s1 |
| InChIKey | KLCIPWXQLBHMOM-QGZVFWFLSA-N |
| XLogP | 1.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|