C24H39NO6 — CID 164672185
tert-butyl 2-[3-[(1S,2S,6S,7R,9S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl]prop-2-enyl]pyrrolidine-1-carboxylate (PubChem CID 164672185) has the molecular formula C24H39NO6 and a molecular weight of 437.58 g/mol. Its IUPAC name is tert-butyl 2-[3-[(1S,2S,6S,7R,9S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl]prop-2-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-[(1S,2S,6S,7R,9S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl]prop-2-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164672185 |
| Molecular Formula | C24H39NO6 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | tert-butyl 2-[3-[(1S,2S,6S,7R,9S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl]prop-2-enyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CC=C[C@H]1C[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C24H39NO6/c1-22(2,3)31-21(26)25-13-9-12-16(25)11-8-10-15-14-17-19(29-23(4,5)27-17)20-18(15)28-24(6,7)30-20/h8,10,15-20H,9,11-14H2,1-7H3/t15-,16?,17-,18-,19-,20-/m0/s1 |
| InChIKey | VTIDNJYNJUBFLY-SNEAHAEPSA-N |
| XLogP | 4.39 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|