C19H26ClNO2 — CID 19367194
tert-butyl 2-[(E)-3-(4-chlorophenyl)prop-2-enyl]piperidine-1-carboxylate (PubChem CID 19367194) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is tert-butyl 2-[(E)-3-(4-chlorophenyl)prop-2-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(E)-3-(4-chlorophenyl)prop-2-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 19367194 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | tert-butyl 2-[(E)-3-(4-chlorophenyl)prop-2-enyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H26ClNO2/c1-19(2,3)23-18(22)21-14-5-4-8-17(21)9-6-7-15-10-12-16(20)13-11-15/h6-7,10-13,17H,4-5,8-9,14H2,1-3H3/b7-6+ |
| InChIKey | JPTZFBZZZVDFRL-VOTSOKGWSA-N |
| XLogP | 5.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |