C22H36N2O — CID 164672395
2-(2-adamantylamino)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]acetamide (PubChem CID 164672395) has the molecular formula C22H36N2O and a molecular weight of 344.54 g/mol. Its IUPAC name is 2-(2-adamantylamino)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]acetamide.
| Compound Name | 2-(2-adamantylamino)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]acetamide |
|---|---|
| PubChem CID | 164672395 |
| Molecular Formula | C22H36N2O |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | 2-(2-adamantylamino)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]acetamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)CNC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H36N2O/c1-15(2)5-4-6-16(3)7-8-23-21(25)14-24-22-19-10-17-9-18(12-19)13-20(22)11-17/h5,7,17-20,22,24H,4,6,8-14H2,1-3H3,(H,23,25)/b16-7+ |
| InChIKey | ZGSFBXVSRRFBDI-FRKPEAEDSA-N |
| XLogP | 4.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|