C27H25O5P — CID 164673166
dimethyl 7-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 164673166) has the molecular formula C27H25O5P and a molecular weight of 460.47 g/mol. Its IUPAC name is dimethyl 7-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 7-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 164673166 |
| Molecular Formula | C27H25O5P |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | dimethyl 7-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C(C)=C(C)C1P2c1ccccc1C#Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H25O5P/c1-16-17(2)25-23(27(29)32-5)22(26(28)31-4)24(16)33(25)21-9-7-6-8-19(21)13-10-18-11-14-20(30-3)15-12-18/h6-9,11-12,14-15,24-25H,1-5H3 |
| InChIKey | GVDXCOJBVJONLW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|