C22H18O6 — CID 139051231
methyl (2R)-4-methoxy-2-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-5-oxo-2H-furan-3-carboxylate (PubChem CID 139051231) has the molecular formula C22H18O6 and a molecular weight of 378.38 g/mol. Its IUPAC name is methyl (2R)-4-methoxy-2-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-5-oxo-2H-furan-3-carboxylate.
| Compound Name | methyl (2R)-4-methoxy-2-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-5-oxo-2H-furan-3-carboxylate |
|---|---|
| PubChem CID | 139051231 |
| Molecular Formula | C22H18O6 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl (2R)-4-methoxy-2-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-5-oxo-2H-furan-3-carboxylate |
| SMILES | COC(=O)C1=C(OC)C(=O)O[C@@H]1c1ccccc1C#Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H18O6/c1-25-16-12-9-14(10-13-16)8-11-15-6-4-5-7-17(15)19-18(21(23)27-3)20(26-2)22(24)28-19/h4-7,9-10,12-13,19H,1-3H3/t19-/m1/s1 |
| InChIKey | MHIBNCHGURXHBQ-LJQANCHMSA-N |
| XLogP | 2.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|