C19H20F3NO3 — CID 164673380
(2,5-dimethylphenyl)methyl (2R)-3,3,3-trifluoro-2-(4-methoxyanilino)propanoate (PubChem CID 164673380) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl (2R)-3,3,3-trifluoro-2-(4-methoxyanilino)propanoate.
| Compound Name | (2,5-dimethylphenyl)methyl (2R)-3,3,3-trifluoro-2-(4-methoxyanilino)propanoate |
|---|---|
| PubChem CID | 164673380 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2,5-dimethylphenyl)methyl (2R)-3,3,3-trifluoro-2-(4-methoxyanilino)propanoate |
| SMILES | COc1ccc(N[C@H](C(=O)OCc2cc(C)ccc2C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3NO3/c1-12-4-5-13(2)14(10-12)11-26-18(24)17(19(20,21)22)23-15-6-8-16(25-3)9-7-15/h4-10,17,23H,11H2,1-3H3/t17-/m1/s1 |
| InChIKey | RXIGPCDTMMCOIU-QGZVFWFLSA-N |
| XLogP | 4.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|