C13H18O5 — CID 164673422
2-[(4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-6-oxo-1,3,7-trioxaspiro[4.4]nonan-4-yl]acetaldehyde (PubChem CID 164673422) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-[(4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-6-oxo-1,3,7-trioxaspiro[4.4]nonan-4-yl]acetaldehyde.
| Compound Name | 2-[(4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-6-oxo-1,3,7-trioxaspiro[4.4]nonan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 164673422 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[(4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-6-oxo-1,3,7-trioxaspiro[4.4]nonan-4-yl]acetaldehyde |
| SMILES | C=C[C@]1(C)COC(=O)[C@@]12OC(C)(C)O[C@@H]2CC=O |
| InChI | InChI=1S/C13H18O5/c1-5-12(4)8-16-10(15)13(12)9(6-7-14)17-11(2,3)18-13/h5,7,9H,1,6,8H2,2-4H3/t9-,12-,13-/m1/s1 |
| InChIKey | KDELIZKXDQYSRQ-OASPWFOLSA-N |
| XLogP | 1.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|