C11H18F2 — CID 164674098
1,1-difluoro-4,8-dimethylnona-1,7-diene (PubChem CID 164674098) has the molecular formula C11H18F2 and a molecular weight of 188.26 g/mol. Its IUPAC name is 1,1-difluoro-4,8-dimethylnona-1,7-diene.
| Compound Name | 1,1-difluoro-4,8-dimethylnona-1,7-diene |
|---|---|
| PubChem CID | 164674098 |
| Molecular Formula | C11H18F2 |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 1,1-difluoro-4,8-dimethylnona-1,7-diene |
| SMILES | CC(C)=CCCC(C)CC=C(F)F |
| InChI | InChI=1S/C11H18F2/c1-9(2)5-4-6-10(3)7-8-11(12)13/h5,8,10H,4,6-7H2,1-3H3 |
| InChIKey | HDSHNKVBFGKJCK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|