C16H20BrNO — CID 164674394
10-bromo-6-methyl-4-prop-2-enyl-1,2,6,7,7a,8-hexahydrocyclopenta[e]quinolin-3-one (PubChem CID 164674394) has the molecular formula C16H20BrNO and a molecular weight of 322.25 g/mol. Its IUPAC name is 10-bromo-6-methyl-4-prop-2-enyl-1,2,6,7,7a,8-hexahydrocyclopenta[e]quinolin-3-one.
| Compound Name | 10-bromo-6-methyl-4-prop-2-enyl-1,2,6,7,7a,8-hexahydrocyclopenta[e]quinolin-3-one |
|---|---|
| PubChem CID | 164674394 |
| Molecular Formula | C16H20BrNO |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 10-bromo-6-methyl-4-prop-2-enyl-1,2,6,7,7a,8-hexahydrocyclopenta[e]quinolin-3-one |
| SMILES | C=CCN1C(=O)CCC23C(Br)=CCC2CC(C)C=C13 |
| InChI | InChI=1S/C16H20BrNO/c1-3-8-18-14-10-11(2)9-12-4-5-13(17)16(12,14)7-6-15(18)19/h3,5,10-12H,1,4,6-9H2,2H3 |
| InChIKey | GCQKRDPFHPMSBC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|