C16H19F2NO3 — CID 164674637
ethyl (E)-2,2-difluoro-7-(N-methylanilino)-7-oxohept-5-enoate (PubChem CID 164674637) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is ethyl (E)-2,2-difluoro-7-(N-methylanilino)-7-oxohept-5-enoate.
| Compound Name | ethyl (E)-2,2-difluoro-7-(N-methylanilino)-7-oxohept-5-enoate |
|---|---|
| PubChem CID | 164674637 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | ethyl (E)-2,2-difluoro-7-(N-methylanilino)-7-oxohept-5-enoate |
| SMILES | CCOC(=O)C(F)(F)CC/C=C/C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C16H19F2NO3/c1-3-22-15(21)16(17,18)12-8-7-11-14(20)19(2)13-9-5-4-6-10-13/h4-7,9-11H,3,8,12H2,1-2H3/b11-7+ |
| InChIKey | GXKJDDWJQDMCRH-YRNVUSSQSA-N |
| XLogP | 3.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|