C13H22O3 — CID 164674974
(1S,3S,4R,5R)-4-[2-(1-hydroxycyclopropyl)ethyl]-5-prop-2-enylcyclopentane-1,3-diol (PubChem CID 164674974) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (1S,3S,4R,5R)-4-[2-(1-hydroxycyclopropyl)ethyl]-5-prop-2-enylcyclopentane-1,3-diol.
| Compound Name | (1S,3S,4R,5R)-4-[2-(1-hydroxycyclopropyl)ethyl]-5-prop-2-enylcyclopentane-1,3-diol |
|---|---|
| PubChem CID | 164674974 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (1S,3S,4R,5R)-4-[2-(1-hydroxycyclopropyl)ethyl]-5-prop-2-enylcyclopentane-1,3-diol |
| SMILES | C=CC[C@@H]1[C@@H](CCC2(O)CC2)[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C13H22O3/c1-2-3-9-10(12(15)8-11(9)14)4-5-13(16)6-7-13/h2,9-12,14-16H,1,3-8H2/t9-,10-,11+,12+/m1/s1 |
| InChIKey | HJZZJEFQJUHUFT-WYUUTHIRSA-N |
| XLogP | 1.23 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|