C29H29F2NO2 — CID 164675253
(Z)-3-(3,5-difluorophenyl)-6-phenylmethoxy-2-(3-phenylmethoxypropyl)hex-2-enenitrile (PubChem CID 164675253) has the molecular formula C29H29F2NO2 and a molecular weight of 461.55 g/mol. Its IUPAC name is (Z)-3-(3,5-difluorophenyl)-6-phenylmethoxy-2-(3-phenylmethoxypropyl)hex-2-enenitrile.
| Compound Name | (Z)-3-(3,5-difluorophenyl)-6-phenylmethoxy-2-(3-phenylmethoxypropyl)hex-2-enenitrile |
|---|---|
| PubChem CID | 164675253 |
| Molecular Formula | C29H29F2NO2 |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (Z)-3-(3,5-difluorophenyl)-6-phenylmethoxy-2-(3-phenylmethoxypropyl)hex-2-enenitrile |
| SMILES | N#C/C(CCCOCc1ccccc1)=C(/CCCOCc1ccccc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C29H29F2NO2/c30-27-17-26(18-28(31)19-27)29(14-8-16-34-22-24-11-5-2-6-12-24)25(20-32)13-7-15-33-21-23-9-3-1-4-10-23/h1-6,9-12,17-19H,7-8,13-16,21-22H2/b29-25- |
| InChIKey | YJQDPHBLHMOZQH-GNVQSUKOSA-N |
| XLogP | 7.24 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|