C20H22FNO4 — CID 170714569
(2R)-3-(2-fluorophenyl)-2-(4-phenylmethoxybutanoylamino)propanoic acid (PubChem CID 170714569) has the molecular formula C20H22FNO4 and a molecular weight of 359.40 g/mol. Its IUPAC name is (2R)-3-(2-fluorophenyl)-2-(4-phenylmethoxybutanoylamino)propanoic acid.
| Compound Name | (2R)-3-(2-fluorophenyl)-2-(4-phenylmethoxybutanoylamino)propanoic acid |
|---|---|
| PubChem CID | 170714569 |
| Molecular Formula | C20H22FNO4 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (2R)-3-(2-fluorophenyl)-2-(4-phenylmethoxybutanoylamino)propanoic acid |
| SMILES | O=C(CCCOCc1ccccc1)N[C@H](Cc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C20H22FNO4/c21-17-10-5-4-9-16(17)13-18(20(24)25)22-19(23)11-6-12-26-14-15-7-2-1-3-8-15/h1-5,7-10,18H,6,11-14H2,(H,22,23)(H,24,25)/t18-/m1/s1 |
| InChIKey | YNPZKLVCKDNYIG-GOSISDBHSA-N |
| XLogP | 2.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|