C31H34N4O3 — CID 164675394
benzyl (1R,2S,5R,9R)-7-amino-13-methoxy-9-methyl-5-(2-phenylethyl)-6,8,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-7,10(15),11,13-tetraene-16-carboxylate (PubChem CID 164675394) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is benzyl (1R,2S,5R,9R)-7-amino-13-methoxy-9-methyl-5-(2-phenylethyl)-6,8,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-7,10(15),11,13-tetraene-16-carboxylate.
| Compound Name | benzyl (1R,2S,5R,9R)-7-amino-13-methoxy-9-methyl-5-(2-phenylethyl)-6,8,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-7,10(15),11,13-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 164675394 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | benzyl (1R,2S,5R,9R)-7-amino-13-methoxy-9-methyl-5-(2-phenylethyl)-6,8,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-7,10(15),11,13-tetraene-16-carboxylate |
| SMILES | COc1ccc2c(c1)N(C(=O)OCc1ccccc1)[C@@H]1[C@@H]3CC[C@@H](CCc4ccccc4)N3C(N)=N[C@]21C |
| InChI | InChI=1S/C31H34N4O3/c1-31-25-17-16-24(37-2)19-27(25)35(30(36)38-20-22-11-7-4-8-12-22)28(31)26-18-15-23(34(26)29(32)33-31)14-13-21-9-5-3-6-10-21/h3-12,16-17,19,23,26,28H,13-15,18,20H2,1-2H3,(H2,32,33)/t23-,26+,28-,31-/m1/s1 |
| InChIKey | RYFKSJQNXCQUDT-FVQRUAPGSA-N |
| XLogP | 5.23 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |