C25H30BNO7 — CID 122396385
1-O-benzyl 2-O-methyl (3S)-5-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1,2-dicarboxylate (PubChem CID 122396385) has the molecular formula C25H30BNO7 and a molecular weight of 467.33 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (3S)-5-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (3S)-5-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 122396385 |
| Molecular Formula | C25H30BNO7 |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (3S)-5-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1,2-dicarboxylate |
| SMILES | COC(=O)C1[C@@H](B2OC(C)(C)C(C)(C)O2)c2cc(OC)ccc2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H30BNO7/c1-24(2)25(3,4)34-26(33-24)20-18-14-17(30-5)12-13-19(18)27(21(20)22(28)31-6)23(29)32-15-16-10-8-7-9-11-16/h7-14,20-21H,15H2,1-6H3/t20-,21?/m0/s1 |
| InChIKey | WPKCASKJCSEXRF-BGERDNNASA-N |
| XLogP | 4.11 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|