C17H24FP — CID 164676835
2,3-dibutyl-6-fluoro-1-methylphosphindole (PubChem CID 164676835) has the molecular formula C17H24FP and a molecular weight of 278.35 g/mol. Its IUPAC name is 2,3-dibutyl-6-fluoro-1-methylphosphindole.
| Compound Name | 2,3-dibutyl-6-fluoro-1-methylphosphindole |
|---|---|
| PubChem CID | 164676835 |
| Molecular Formula | C17H24FP |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2,3-dibutyl-6-fluoro-1-methylphosphindole |
| SMILES | CCCCc1c(CCCC)p(C)c2cc(F)ccc12 |
| InChI | InChI=1S/C17H24FP/c1-4-6-8-14-15-11-10-13(18)12-17(15)19(3)16(14)9-7-5-2/h10-12H,4-9H2,1-3H3 |
| InChIKey | FTLPFWQKVKCUBT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |