C11H10Cl3NO3S — CID 164678311
4-(4-methylsulfonylphenyl)-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 164678311) has the molecular formula C11H10Cl3NO3S and a molecular weight of 342.63 g/mol. Its IUPAC name is 4-(4-methylsulfonylphenyl)-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(4-methylsulfonylphenyl)-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 164678311 |
| Molecular Formula | C11H10Cl3NO3S |
| Molecular Weight | 342.63 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 4-(4-methylsulfonylphenyl)-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CS(=O)(=O)c1ccc(C2COC(C(Cl)(Cl)Cl)=N2)cc1 |
| InChI | InChI=1S/C11H10Cl3NO3S/c1-19(16,17)8-4-2-7(3-5-8)9-6-18-10(15-9)11(12,13)14/h2-5,9H,6H2,1H3 |
| InChIKey | KBSJQFQMNUMNTF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|