C22H33NSi — CID 164678515
N-ethyl-N-[[(4E)-1-prop-2-enyl-4-(trimethylsilylmethylidene)naphthalen-1-yl]methyl]ethanamine (PubChem CID 164678515) has the molecular formula C22H33NSi and a molecular weight of 339.60 g/mol. Its IUPAC name is N-ethyl-N-[[(4E)-1-prop-2-enyl-4-(trimethylsilylmethylidene)naphthalen-1-yl]methyl]ethanamine.
| Compound Name | N-ethyl-N-[[(4E)-1-prop-2-enyl-4-(trimethylsilylmethylidene)naphthalen-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 164678515 |
| Molecular Formula | C22H33NSi |
| Molecular Weight | 339.60 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N-ethyl-N-[[(4E)-1-prop-2-enyl-4-(trimethylsilylmethylidene)naphthalen-1-yl]methyl]ethanamine |
| SMILES | C=CCC1(CN(CC)CC)C=C/C(=C\[Si](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C22H33NSi/c1-7-15-22(18-23(8-2)9-3)16-14-19(17-24(4,5)6)20-12-10-11-13-21(20)22/h7,10-14,16-17H,1,8-9,15,18H2,2-6H3/b19-17+ |
| InChIKey | PJSZFGXAQAGIGE-HTXNQAPBSA-N |
| XLogP | 5.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|