C23H27NO10 — CID 164678716
2-[[4-(2-carboxy-2-ethylbutanoyl)oxy-5-oxo-3-phenyl-1,2-oxazol-4-yl]oxycarbonyl]-2-ethylbutanoic acid (PubChem CID 164678716) has the molecular formula C23H27NO10 and a molecular weight of 477.47 g/mol. Its IUPAC name is 2-[[4-(2-carboxy-2-ethylbutanoyl)oxy-5-oxo-3-phenyl-1,2-oxazol-4-yl]oxycarbonyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[4-(2-carboxy-2-ethylbutanoyl)oxy-5-oxo-3-phenyl-1,2-oxazol-4-yl]oxycarbonyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 164678716 |
| Molecular Formula | C23H27NO10 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-[[4-(2-carboxy-2-ethylbutanoyl)oxy-5-oxo-3-phenyl-1,2-oxazol-4-yl]oxycarbonyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(C(=O)O)C(=O)OC1(OC(=O)C(CC)(CC)C(=O)O)C(=O)ON=C1c1ccccc1 |
| InChI | InChI=1S/C23H27NO10/c1-5-21(6-2,16(25)26)18(29)32-23(33-19(30)22(7-3,8-4)17(27)28)15(24-34-20(23)31)14-12-10-9-11-13-14/h9-13H,5-8H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | DVKGJUZQADZDJE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 165.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|