C18H11BrF3NO3 — CID 164678802
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-ethynylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 164678802) has the molecular formula C18H11BrF3NO3 and a molecular weight of 426.19 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-ethynylphenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-ethynylphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 164678802 |
| Molecular Formula | C18H11BrF3NO3 |
| Molecular Weight | 426.19 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-N-(2-ethynylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | C#Cc1ccccc1N(Cc1cc2c(cc1Br)OCO2)C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H11BrF3NO3/c1-2-11-5-3-4-6-14(11)23(17(24)18(20,21)22)9-12-7-15-16(8-13(12)19)26-10-25-15/h1,3-8H,9-10H2 |
| InChIKey | CPDQFNNKKGDWLB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|