C27H27BrN2 — CID 164679428
6-bromo-3,4-diphenyl-N,1-di(propan-2-yl)quinolin-2-imine (PubChem CID 164679428) has the molecular formula C27H27BrN2 and a molecular weight of 459.43 g/mol. Its IUPAC name is 6-bromo-3,4-diphenyl-N,1-di(propan-2-yl)quinolin-2-imine.
| Compound Name | 6-bromo-3,4-diphenyl-N,1-di(propan-2-yl)quinolin-2-imine |
|---|---|
| PubChem CID | 164679428 |
| Molecular Formula | C27H27BrN2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 6-bromo-3,4-diphenyl-N,1-di(propan-2-yl)quinolin-2-imine |
| SMILES | CC(C)/N=c1/c(-c2ccccc2)c(-c2ccccc2)c2cc(Br)ccc2n1C(C)C |
| InChI | InChI=1S/C27H27BrN2/c1-18(2)29-27-26(21-13-9-6-10-14-21)25(20-11-7-5-8-12-20)23-17-22(28)15-16-24(23)30(27)19(3)4/h5-19H,1-4H3/b29-27- |
| InChIKey | VMMHCIKGBREETO-OHYPFYFLSA-N |
| XLogP | 7.63 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |