C27H28N2 — CID 164679430
3,4-diphenyl-N,1-di(propan-2-yl)quinolin-2-imine (PubChem CID 164679430) has the molecular formula C27H28N2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 3,4-diphenyl-N,1-di(propan-2-yl)quinolin-2-imine.
| Compound Name | 3,4-diphenyl-N,1-di(propan-2-yl)quinolin-2-imine |
|---|---|
| PubChem CID | 164679430 |
| Molecular Formula | C27H28N2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 3,4-diphenyl-N,1-di(propan-2-yl)quinolin-2-imine |
| SMILES | CC(C)/N=c1/c(-c2ccccc2)c(-c2ccccc2)c2ccccc2n1C(C)C |
| InChI | InChI=1S/C27H28N2/c1-19(2)28-27-26(22-15-9-6-10-16-22)25(21-13-7-5-8-14-21)23-17-11-12-18-24(23)29(27)20(3)4/h5-20H,1-4H3/b28-27- |
| InChIKey | WMLJRPZCBYUMFP-DQSJHHFOSA-N |
| XLogP | 6.87 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |