About 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one
2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one (PubChem CID 170419866) has the molecular formula C21H19NO2
and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one.
Molecular Properties
| Compound Name | 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one |
| PubChem CID | 170419866 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one |
| SMILES | Cc1oc2c(=O)c3ccccc3n(C(C)C)c2c1-c1ccccc1 |
| InChI | InChI=1S/C21H19NO2/c1-13(2)22-17-12-8-7-11-16(17)20(23)21-19(22)18(14(3)24-21)15-9-5-4-6-10-15/h4-13H,1-3H3 |
| InChIKey | CSWJHEFIHUQPGK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one?
The IUPAC name of 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one (CID 170419866) is 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one.
What is the SMILES notation for 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one?
The canonical SMILES for 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one is Cc1oc2c(=O)c3ccccc3n(C(C)C)c2c1-c1ccccc1.
What is the InChIKey of 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one?
The InChIKey is CSWJHEFIHUQPGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO2/c1-13(2)22-17-12-8-7-11-16(17)20(23)21-19(22)18(14(3)24-21)15-9-5-4-6-10-15/h4-13H,1-3H3.
What are the key properties of 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one?
2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one has a molecular weight of 317.39 g/mol, XLogP of 5.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-phenyl-4-propan-2-ylfuro[3,2-b]quinolin-9-one is sourced from PubChem (CID 170419866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).