C19H14O3 — CID 142746632
2,6-dimethyl-3-phenylfuro[3,2-c]chromen-4-one (PubChem CID 142746632) has the molecular formula C19H14O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2,6-dimethyl-3-phenylfuro[3,2-c]chromen-4-one.
| Compound Name | 2,6-dimethyl-3-phenylfuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 142746632 |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2,6-dimethyl-3-phenylfuro[3,2-c]chromen-4-one |
| SMILES | Cc1oc2c(c1-c1ccccc1)c(=O)oc1c(C)cccc12 |
| InChI | InChI=1S/C19H14O3/c1-11-7-6-10-14-17(11)22-19(20)16-15(12(2)21-18(14)16)13-8-4-3-5-9-13/h3-10H,1-2H3 |
| InChIKey | JJDZBMWMAWNJDR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|