C21H12O6 — CID 53381853
5-hydroxy-7,18-dimethyl-12,20-dioxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4(9),5,7,14,16,18-octaene-3,10,21-trione (PubChem CID 53381853) has the molecular formula C21H12O6 and a molecular weight of 360.32 g/mol. Its IUPAC name is 5-hydroxy-7,18-dimethyl-12,20-dioxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4(9),5,7,14,16,18-octaene-3,10,21-trione.
| Compound Name | 5-hydroxy-7,18-dimethyl-12,20-dioxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4(9),5,7,14,16,18-octaene-3,10,21-trione |
|---|---|
| PubChem CID | 53381853 |
| Molecular Formula | C21H12O6 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 5-hydroxy-7,18-dimethyl-12,20-dioxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4(9),5,7,14,16,18-octaene-3,10,21-trione |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1oc3c(c1C2=O)c(=O)oc1c(C)cccc13 |
| InChI | InChI=1S/C21H12O6/c1-8-6-11-13(12(22)7-8)17(24)14-15-19(26-20(14)16(11)23)10-5-3-4-9(2)18(10)27-21(15)25/h3-7,22H,1-2H3 |
| InChIKey | AGTUEVQOLMJJTO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|