C19H15NO3 — CID 155520337
18-propan-2-yl-5-oxa-18-azapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1(11),2(8),9,12,14,16-hexaene-3,7-dione (PubChem CID 155520337) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is 18-propan-2-yl-5-oxa-18-azapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1(11),2(8),9,12,14,16-hexaene-3,7-dione.
| Compound Name | 18-propan-2-yl-5-oxa-18-azapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1(11),2(8),9,12,14,16-hexaene-3,7-dione |
|---|---|
| PubChem CID | 155520337 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 18-propan-2-yl-5-oxa-18-azapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1(11),2(8),9,12,14,16-hexaene-3,7-dione |
| SMILES | CC(C)n1c2ccccc2c2ccc3c(c21)C(=O)C1OC1C3=O |
| InChI | InChI=1S/C19H15NO3/c1-9(2)20-13-6-4-3-5-10(13)11-7-8-12-14(15(11)20)17(22)19-18(23-19)16(12)21/h3-9,18-19H,1-2H3 |
| InChIKey | VFGARPFMXLIUJR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|