C42H38N2O2 — CID 164679784
1-methyl-3-[2-[2-[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]ethynyl]phenyl]-1-[2-(2-phenylethynyl)phenyl]urea (PubChem CID 164679784) has the molecular formula C42H38N2O2 and a molecular weight of 602.78 g/mol. Its IUPAC name is 1-methyl-3-[2-[2-[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]ethynyl]phenyl]-1-[2-(2-phenylethynyl)phenyl]urea.
| Compound Name | 1-methyl-3-[2-[2-[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]ethynyl]phenyl]-1-[2-(2-phenylethynyl)phenyl]urea |
|---|---|
| PubChem CID | 164679784 |
| Molecular Formula | C42H38N2O2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | 1-methyl-3-[2-[2-[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]ethynyl]phenyl]-1-[2-(2-phenylethynyl)phenyl]urea |
| SMILES | CN(C(=O)Nc1ccccc1C#Cc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12)c1ccccc1C#Cc1ccccc1 |
| InChI | InChI=1S/C42H38N2O2/c1-42-27-26-35-34-22-18-30(28-33(34)21-23-36(35)37(42)24-25-40(42)45)17-19-31-12-6-8-14-38(31)43-41(46)44(2)39-15-9-7-13-32(39)20-16-29-10-4-3-5-11-29/h3-15,18,22,28,35-37H,21,23-27H2,1-2H3,(H,43,46)/t35-,36-,37+,42+/m1/s1 |
| InChIKey | CYPWBDJNXOCTJH-ZHNOXDQPSA-N |
| XLogP | 8.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|