C13H11FO2S — CID 164680260
1-[(1R,2R)-2-fluorocyclopropyl]sulfonylnaphthalene (PubChem CID 164680260) has the molecular formula C13H11FO2S and a molecular weight of 250.29 g/mol. Its IUPAC name is 1-[(1R,2R)-2-fluorocyclopropyl]sulfonylnaphthalene.
| Compound Name | 1-[(1R,2R)-2-fluorocyclopropyl]sulfonylnaphthalene |
|---|---|
| PubChem CID | 164680260 |
| Molecular Formula | C13H11FO2S |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1-[(1R,2R)-2-fluorocyclopropyl]sulfonylnaphthalene |
| SMILES | O=S(=O)(c1cccc2ccccc12)[C@@H]1C[C@H]1F |
| InChI | InChI=1S/C13H11FO2S/c14-11-8-13(11)17(15,16)12-7-3-5-9-4-1-2-6-10(9)12/h1-7,11,13H,8H2/t11-,13-/m1/s1 |
| InChIKey | NRORNJKXYTUTSK-DGCLKSJQSA-N |
| XLogP | 2.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |