C29H30N2O3 — CID 164680374
(4R,5S)-N-cyclohexyl-2-(3-methoxyphenyl)-4,5-diphenyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 164680374) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is (4R,5S)-N-cyclohexyl-2-(3-methoxyphenyl)-4,5-diphenyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5S)-N-cyclohexyl-2-(3-methoxyphenyl)-4,5-diphenyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 164680374 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (4R,5S)-N-cyclohexyl-2-(3-methoxyphenyl)-4,5-diphenyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc(C2=N[C@](C(=O)NC3CCCCC3)(c3ccccc3)[C@H](c3ccccc3)O2)c1 |
| InChI | InChI=1S/C29H30N2O3/c1-33-25-19-11-14-22(20-25)27-31-29(23-15-7-3-8-16-23,26(34-27)21-12-5-2-6-13-21)28(32)30-24-17-9-4-10-18-24/h2-3,5-8,11-16,19-20,24,26H,4,9-10,17-18H2,1H3,(H,30,32)/t26-,29+/m0/s1 |
| InChIKey | YOHNORLFJLCLBR-LITSAYRRSA-N |
| XLogP | 5.56 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |