C21H21NO3 — CID 164682585
methyl (2R,3S)-1-methyl-2-(2-methylphenyl)-4-oxo-3-[(E)-2-phenylethenyl]azetidine-3-carboxylate (PubChem CID 164682585) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl (2R,3S)-1-methyl-2-(2-methylphenyl)-4-oxo-3-[(E)-2-phenylethenyl]azetidine-3-carboxylate.
| Compound Name | methyl (2R,3S)-1-methyl-2-(2-methylphenyl)-4-oxo-3-[(E)-2-phenylethenyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 164682585 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | methyl (2R,3S)-1-methyl-2-(2-methylphenyl)-4-oxo-3-[(E)-2-phenylethenyl]azetidine-3-carboxylate |
| SMILES | COC(=O)[C@]1(/C=C/c2ccccc2)C(=O)N(C)[C@@H]1c1ccccc1C |
| InChI | InChI=1S/C21H21NO3/c1-15-9-7-8-12-17(15)18-21(20(24)25-3,19(23)22(18)2)14-13-16-10-5-4-6-11-16/h4-14,18H,1-3H3/b14-13+/t18-,21+/m1/s1 |
| InChIKey | DYAPSDTUNZBUEP-FXIHAIIISA-N |
| XLogP | 3.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|