C21H30O3 — CID 164682657
tert-butyl (E,2S)-2-acetyl-2-methyl-8-phenyloct-4-enoate (PubChem CID 164682657) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl (E,2S)-2-acetyl-2-methyl-8-phenyloct-4-enoate.
| Compound Name | tert-butyl (E,2S)-2-acetyl-2-methyl-8-phenyloct-4-enoate |
|---|---|
| PubChem CID | 164682657 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | tert-butyl (E,2S)-2-acetyl-2-methyl-8-phenyloct-4-enoate |
| SMILES | CC(=O)[C@](C)(C/C=C/CCCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30O3/c1-17(22)21(5,19(23)24-20(2,3)4)16-12-7-6-9-13-18-14-10-8-11-15-18/h7-8,10-12,14-15H,6,9,13,16H2,1-5H3/b12-7+/t21-/m0/s1 |
| InChIKey | FQWGAQCKXSOZFB-SQEWALACSA-N |
| XLogP | 4.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|